About N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide
N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide (PubChem CID 68738967) has the molecular formula C6H6F2N2OS
and a molecular weight of 192.19 g/mol. Its IUPAC name is N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 68738967 |
| Molecular Formula | C6H6F2N2OS |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncc(C(=O)NC(F)F)s1 |
| InChI | InChI=1S/C6H6F2N2OS/c1-3-9-2-4(12-3)5(11)10-6(7)8/h2,6H,1H3,(H,10,11) |
| InChIKey | DPSAOUUUHWIGTD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide?
The IUPAC name of N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide (CID 68738967) is N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide is Cc1ncc(C(=O)NC(F)F)s1.
What is the InChIKey of N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide?
The InChIKey is DPSAOUUUHWIGTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6F2N2OS/c1-3-9-2-4(12-3)5(11)10-6(7)8/h2,6H,1H3,(H,10,11).
What are the key properties of N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide?
N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide has a molecular weight of 192.19 g/mol, XLogP of 1.40, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 68738967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).