C28H48OSi2 — CID 68740299
[3-[diethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silyl]-2-methoxy-5-methylphenyl]-(2,2-dimethylpropyl)-dimethylsilane (PubChem CID 68740299) has the molecular formula C28H48OSi2 and a molecular weight of 456.86 g/mol. Its IUPAC name is [3-[diethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silyl]-2-methoxy-5-methylphenyl]-(2,2-dimethylpropyl)-dimethylsilane.
| Compound Name | [3-[diethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silyl]-2-methoxy-5-methylphenyl]-(2,2-dimethylpropyl)-dimethylsilane |
|---|---|
| PubChem CID | 68740299 |
| Molecular Formula | C28H48OSi2 |
| Molecular Weight | 456.86 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | [3-[diethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silyl]-2-methoxy-5-methylphenyl]-(2,2-dimethylpropyl)-dimethylsilane |
| SMILES | CC[Si](CC)(C1=C(C)C(C)=C(C)C1C)c1cc(C)cc([Si](C)(C)CC(C)(C)C)c1OC |
| InChI | InChI=1S/C28H48OSi2/c1-14-31(15-2,27-22(6)20(4)21(5)23(27)7)25-17-19(3)16-24(26(25)29-11)30(12,13)18-28(8,9)10/h16-17,22H,14-15,18H2,1-13H3 |
| InChIKey | XOPIMCUAURGEBD-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.86 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|