C13H18N2 — CID 68741157
1,2-dimethyl-1,3,4,4a,4b,5-hexahydropyrido[3,4-b]indole (PubChem CID 68741157) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 1,2-dimethyl-1,3,4,4a,4b,5-hexahydropyrido[3,4-b]indole.
| Compound Name | 1,2-dimethyl-1,3,4,4a,4b,5-hexahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 68741157 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1,2-dimethyl-1,3,4,4a,4b,5-hexahydropyrido[3,4-b]indole |
| SMILES | CC1C2=NC3=CC=CCC3C2CCN1C |
| InChI | InChI=1S/C13H18N2/c1-9-13-11(7-8-15(9)2)10-5-3-4-6-12(10)14-13/h3-4,6,9-11H,5,7-8H2,1-2H3 |
| InChIKey | CBXPGLGVGDAYMC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |