C25H37NO — CID 68741582
(9Z,12Z,15Z)-N-benzyloctadeca-9,12,15-trienamide (PubChem CID 68741582) has the molecular formula C25H37NO and a molecular weight of 367.58 g/mol. Its IUPAC name is (9Z,12Z,15Z)-N-benzyloctadeca-9,12,15-trienamide.
| Compound Name | (9Z,12Z,15Z)-N-benzyloctadeca-9,12,15-trienamide |
|---|---|
| PubChem CID | 68741582 |
| Molecular Formula | C25H37NO |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.29 |
| IUPAC Name | (9Z,12Z,15Z)-N-benzyloctadeca-9,12,15-trienamide |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-25(27)26-23-24-20-17-16-18-21-24/h3-4,6-7,9-10,16-18,20-21H,2,5,8,11-15,19,22-23H2,1H3,(H,26,27)/b4-3-,7-6-,10-9- |
| InChIKey | VCMMYRWIEZCYDK-PDBXOOCHSA-N |
| XLogP | 6.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|