About CID 68741617
CID 68741617 (PubChem CID 68741617) has the molecular formula C26H29F5KN6O4
and a molecular weight of 623.64 g/mol.
Molecular Properties
| Compound Name | CID 68741617 |
| PubChem CID | 68741617 |
| Molecular Formula | C26H29F5KN6O4 |
| Molecular Weight | 623.64 g/mol |
| Exact Mass | 623.18 |
| IUPAC Name | — |
| SMILES | O.O=C1[C@H](NC(=O)N2CCCCC2n2c(=O)[nH]c3ncccc32)CC[C@@H](c2cccc(F)c2F)CN1CC(F)(F)F.[K] |
| InChI | InChI=1S/C26H27F5N6O3.K.H2O/c27-17-6-3-5-16(21(17)28)15-9-10-18(23(38)35(13-15)14-26(29,30)31)33-24(39)36-12-2-1-8-20(36)37-19-7-4-11-32-22(19)34-25(37)40;;/h3-7,11,15,18,20H,1-2,8-10,12-14H2,(H,33,39)(H,32,34,40);;1H2/t15-,18-,20?;;/m1../s1 |
| InChIKey | VJOSWUFQKWBNKP-CHZHSIDBSA-N |
| XLogP | 2.83 |
| TPSA | 134.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 623.64 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 68741617 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68741617?
The IUPAC name of CID 68741617 (CID 68741617) is not available.
What is the SMILES notation for CID 68741617?
The canonical SMILES for CID 68741617 is O.O=C1[C@H](NC(=O)N2CCCCC2n2c(=O)[nH]c3ncccc32)CC[C@@H](c2cccc(F)c2F)CN1CC(F)(F)F.[K].
What is the InChIKey of CID 68741617?
The InChIKey is VJOSWUFQKWBNKP-CHZHSIDBSA-N. The full InChI is InChI=1S/C26H27F5N6O3.K.H2O/c27-17-6-3-5-16(21(17)28)15-9-10-18(23(38)35(13-15)14-26(29,30)31)33-24(39)36-12-2-1-8-20(36)37-19-7-4-11-32-22(19)34-25(37)40;;/h3-7,11,15,18,20H,1-2,8-10,12-14H2,(H,33,39)(H,32,34,40);;1H2/t15-,18-,20?;;/m1../s1.
What are the key properties of CID 68741617?
CID 68741617 has a molecular weight of 623.64 g/mol, XLogP of 2.83, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68741617 is sourced from PubChem (CID 68741617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).