C11H14O4 — CID 68741703
(3aR,4R,5R,6aS)-5-hydroxy-4-(3-oxobut-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 68741703) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-5-hydroxy-4-(3-oxobut-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-5-hydroxy-4-(3-oxobut-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 68741703 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (3aR,4R,5R,6aS)-5-hydroxy-4-(3-oxobut-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CC(=O)C=C[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C11H14O4/c1-6(12)2-3-7-8-4-11(14)15-10(8)5-9(7)13/h2-3,7-10,13H,4-5H2,1H3/t7-,8-,9-,10+/m1/s1 |
| InChIKey | QGCVCXUCRBGHGQ-KYXWUPHJSA-N |
| XLogP | 0.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|