C25H39NO — CID 68742556
(9Z,12Z)-N-benzyloctadeca-9,12-dienamide (PubChem CID 68742556) has the molecular formula C25H39NO and a molecular weight of 369.59 g/mol. Its IUPAC name is (9Z,12Z)-N-benzyloctadeca-9,12-dienamide.
| Compound Name | (9Z,12Z)-N-benzyloctadeca-9,12-dienamide |
|---|---|
| PubChem CID | 68742556 |
| Molecular Formula | C25H39NO |
| Molecular Weight | 369.59 g/mol |
| Exact Mass | 369.30 |
| IUPAC Name | (9Z,12Z)-N-benzyloctadeca-9,12-dienamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H39NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-25(27)26-23-24-20-17-16-18-21-24/h6-7,9-10,16-18,20-21H,2-5,8,11-15,19,22-23H2,1H3,(H,26,27)/b7-6-,10-9- |
| InChIKey | YJWLCIANOBCQGW-HZJYTTRNSA-N |
| XLogP | 7.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.59 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|