C26H37F3N2O6S2 — CID 68742923
[3-carboxy-2-[[5-[2-(4-pentylphenyl)ethyl]thiophen-2-yl]sulfonylamino]propyl]-trimethylazanium;2,2,2-trifluoroacetate (PubChem CID 68742923) has the molecular formula C26H37F3N2O6S2 and a molecular weight of 594.72 g/mol. Its IUPAC name is [3-carboxy-2-[[5-[2-(4-pentylphenyl)ethyl]thiophen-2-yl]sulfonylamino]propyl]-trimethylazanium;2,2,2-trifluoroacetate.
| Compound Name | [3-carboxy-2-[[5-[2-(4-pentylphenyl)ethyl]thiophen-2-yl]sulfonylamino]propyl]-trimethylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68742923 |
| Molecular Formula | C26H37F3N2O6S2 |
| Molecular Weight | 594.72 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | [3-carboxy-2-[[5-[2-(4-pentylphenyl)ethyl]thiophen-2-yl]sulfonylamino]propyl]-trimethylazanium;2,2,2-trifluoroacetate |
| SMILES | CCCCCc1ccc(CCc2ccc(S(=O)(=O)NC(CC(=O)O)C[N+](C)(C)C)s2)cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C24H36N2O4S2.C2HF3O2/c1-5-6-7-8-19-9-11-20(12-10-19)13-14-22-15-16-24(31-22)32(29,30)25-21(17-23(27)28)18-26(2,3)4;3-2(4,5)1(6)7/h9-12,15-16,21,25H,5-8,13-14,17-18H2,1-4H3;(H,6,7) |
| InChIKey | SFQUAULNUNWVRK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.72 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|