C26H19F2N9O2 — CID 68743076
4-(2,2-difluoro-1,3-benzodioxol-5-yl)-7-methyl-8-[3-(7H-purin-6-yl)-2-pyridinyl]quinazoline;hydrazine (PubChem CID 68743076) has the molecular formula C26H19F2N9O2 and a molecular weight of 527.50 g/mol. Its IUPAC name is 4-(2,2-difluoro-1,3-benzodioxol-5-yl)-7-methyl-8-[3-(7H-purin-6-yl)-2-pyridinyl]quinazoline;hydrazine.
| Compound Name | 4-(2,2-difluoro-1,3-benzodioxol-5-yl)-7-methyl-8-[3-(7H-purin-6-yl)-2-pyridinyl]quinazoline;hydrazine |
|---|---|
| PubChem CID | 68743076 |
| Molecular Formula | C26H19F2N9O2 |
| Molecular Weight | 527.50 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 4-(2,2-difluoro-1,3-benzodioxol-5-yl)-7-methyl-8-[3-(7H-purin-6-yl)-2-pyridinyl]quinazoline;hydrazine |
| SMILES | Cc1ccc2c(-c3ccc4c(c3)OC(F)(F)O4)ncnc2c1-c1ncccc1-c1ncnc2nc[nH]c12.NN |
| InChI | InChI=1S/C26H15F2N7O2.H4N2/c1-13-4-6-16-20(14-5-7-17-18(9-14)37-26(27,28)36-17)30-10-31-22(16)19(13)21-15(3-2-8-29-21)23-24-25(34-11-32-23)35-12-33-24;1-2/h2-12H,1H3,(H,32,33,34,35);1-2H2 |
| InChIKey | XXJFTTXWVSNGLD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 163.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|