About benzene;(4R)-4-methyl-3-(4-methylheptanoyl)-1,3-oxazolidin-2-one
benzene;(4R)-4-methyl-3-(4-methylheptanoyl)-1,3-oxazolidin-2-one (PubChem CID 68743418) has the molecular formula C18H27NO3
and a molecular weight of 305.42 g/mol. Its IUPAC name is benzene;(4R)-4-methyl-3-(4-methylheptanoyl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | benzene;(4R)-4-methyl-3-(4-methylheptanoyl)-1,3-oxazolidin-2-one |
| PubChem CID | 68743418 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | benzene;(4R)-4-methyl-3-(4-methylheptanoyl)-1,3-oxazolidin-2-one |
| SMILES | CCCC(C)CCC(=O)N1C(=O)OC[C@H]1C.c1ccccc1 |
| InChI | InChI=1S/C12H21NO3.C6H6/c1-4-5-9(2)6-7-11(14)13-10(3)8-16-12(13)15;1-2-4-6-5-3-1/h9-10H,4-8H2,1-3H3;1-6H/t9?,10-;/m1./s1 |
| InChIKey | PYCXLXFDRRYEDF-FJYJDOHQSA-N |
| XLogP | 4.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzene;(4R)-4-methyl-3-(4-methylheptanoyl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;(4R)-4-methyl-3-(4-methylheptanoyl)-1,3-oxazolidin-2-one?
The IUPAC name of benzene;(4R)-4-methyl-3-(4-methylheptanoyl)-1,3-oxazolidin-2-one (CID 68743418) is benzene;(4R)-4-methyl-3-(4-methylheptanoyl)-1,3-oxazolidin-2-one.
What is the SMILES notation for benzene;(4R)-4-methyl-3-(4-methylheptanoyl)-1,3-oxazolidin-2-one?
The canonical SMILES for benzene;(4R)-4-methyl-3-(4-methylheptanoyl)-1,3-oxazolidin-2-one is CCCC(C)CCC(=O)N1C(=O)OC[C@H]1C.c1ccccc1.
What is the InChIKey of benzene;(4R)-4-methyl-3-(4-methylheptanoyl)-1,3-oxazolidin-2-one?
The InChIKey is PYCXLXFDRRYEDF-FJYJDOHQSA-N. The full InChI is InChI=1S/C12H21NO3.C6H6/c1-4-5-9(2)6-7-11(14)13-10(3)8-16-12(13)15;1-2-4-6-5-3-1/h9-10H,4-8H2,1-3H3;1-6H/t9?,10-;/m1./s1.
What are the key properties of benzene;(4R)-4-methyl-3-(4-methylheptanoyl)-1,3-oxazolidin-2-one?
benzene;(4R)-4-methyl-3-(4-methylheptanoyl)-1,3-oxazolidin-2-one has a molecular weight of 305.42 g/mol, XLogP of 4.26, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;(4R)-4-methyl-3-(4-methylheptanoyl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 68743418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).