C14H20F3N3O6 — CID 68743438
[(2R)-3-carboxy-2-[(4-methyl-1,3-oxazole-5-carbonyl)amino]propyl]-trimethylazanium;2,2,2-trifluoroacetate (PubChem CID 68743438) has the molecular formula C14H20F3N3O6 and a molecular weight of 383.32 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[(4-methyl-1,3-oxazole-5-carbonyl)amino]propyl]-trimethylazanium;2,2,2-trifluoroacetate.
| Compound Name | [(2R)-3-carboxy-2-[(4-methyl-1,3-oxazole-5-carbonyl)amino]propyl]-trimethylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68743438 |
| Molecular Formula | C14H20F3N3O6 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | [(2R)-3-carboxy-2-[(4-methyl-1,3-oxazole-5-carbonyl)amino]propyl]-trimethylazanium;2,2,2-trifluoroacetate |
| SMILES | Cc1ncoc1C(=O)N[C@H](CC(=O)O)C[N+](C)(C)C.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C12H19N3O4.C2HF3O2/c1-8-11(19-7-13-8)12(18)14-9(5-10(16)17)6-15(2,3)4;3-2(4,5)1(6)7/h7,9H,5-6H2,1-4H3,(H-,14,16,17,18);(H,6,7)/t9-;/m1./s1 |
| InChIKey | JNTLZVMMWZSVPV-SBSPUUFOSA-N |
| XLogP | -0.44 |
| TPSA | 132.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|