About bis(1-ethyl-3-methyl-2H-imidazol-2-yl) 2,3-dihydroxybutanedioate
bis(1-ethyl-3-methyl-2H-imidazol-2-yl) 2,3-dihydroxybutanedioate (PubChem CID 68743808) has the molecular formula C16H26N4O6
and a molecular weight of 370.41 g/mol. Its IUPAC name is bis(1-ethyl-3-methyl-2H-imidazol-2-yl) 2,3-dihydroxybutanedioate.
Molecular Properties
| Compound Name | bis(1-ethyl-3-methyl-2H-imidazol-2-yl) 2,3-dihydroxybutanedioate |
| PubChem CID | 68743808 |
| Molecular Formula | C16H26N4O6 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | bis(1-ethyl-3-methyl-2H-imidazol-2-yl) 2,3-dihydroxybutanedioate |
| SMILES | CCN1C=CN(C)C1OC(=O)C(O)C(O)C(=O)OC1N(C)C=CN1CC |
| InChI | InChI=1S/C16H26N4O6/c1-5-19-9-7-17(3)15(19)25-13(23)11(21)12(22)14(24)26-16-18(4)8-10-20(16)6-2/h7-12,15-16,21-22H,5-6H2,1-4H3 |
| InChIKey | YFFWIJBOVMXCMC-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze bis(1-ethyl-3-methyl-2H-imidazol-2-yl) 2,3-dihydroxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-ethyl-3-methyl-2H-imidazol-2-yl) 2,3-dihydroxybutanedioate?
The IUPAC name of bis(1-ethyl-3-methyl-2H-imidazol-2-yl) 2,3-dihydroxybutanedioate (CID 68743808) is bis(1-ethyl-3-methyl-2H-imidazol-2-yl) 2,3-dihydroxybutanedioate.
What is the SMILES notation for bis(1-ethyl-3-methyl-2H-imidazol-2-yl) 2,3-dihydroxybutanedioate?
The canonical SMILES for bis(1-ethyl-3-methyl-2H-imidazol-2-yl) 2,3-dihydroxybutanedioate is CCN1C=CN(C)C1OC(=O)C(O)C(O)C(=O)OC1N(C)C=CN1CC.
What is the InChIKey of bis(1-ethyl-3-methyl-2H-imidazol-2-yl) 2,3-dihydroxybutanedioate?
The InChIKey is YFFWIJBOVMXCMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4O6/c1-5-19-9-7-17(3)15(19)25-13(23)11(21)12(22)14(24)26-16-18(4)8-10-20(16)6-2/h7-12,15-16,21-22H,5-6H2,1-4H3.
What are the key properties of bis(1-ethyl-3-methyl-2H-imidazol-2-yl) 2,3-dihydroxybutanedioate?
bis(1-ethyl-3-methyl-2H-imidazol-2-yl) 2,3-dihydroxybutanedioate has a molecular weight of 370.41 g/mol, XLogP of -1.16, 7 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-ethyl-3-methyl-2H-imidazol-2-yl) 2,3-dihydroxybutanedioate is sourced from PubChem (CID 68743808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).