C21H32O2Si — CID 68743959
(3-tert-butyl-2,5-dimethoxyphenyl)-cyclopenta-1,3-dien-1-yl-diethylsilane (PubChem CID 68743959) has the molecular formula C21H32O2Si and a molecular weight of 344.57 g/mol. Its IUPAC name is (3-tert-butyl-2,5-dimethoxyphenyl)-cyclopenta-1,3-dien-1-yl-diethylsilane.
| Compound Name | (3-tert-butyl-2,5-dimethoxyphenyl)-cyclopenta-1,3-dien-1-yl-diethylsilane |
|---|---|
| PubChem CID | 68743959 |
| Molecular Formula | C21H32O2Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (3-tert-butyl-2,5-dimethoxyphenyl)-cyclopenta-1,3-dien-1-yl-diethylsilane |
| SMILES | CC[Si](CC)(C1=CC=CC1)c1cc(OC)cc(C(C)(C)C)c1OC |
| InChI | InChI=1S/C21H32O2Si/c1-8-24(9-2,17-12-10-11-13-17)19-15-16(22-6)14-18(20(19)23-7)21(3,4)5/h10-12,14-15H,8-9,13H2,1-7H3 |
| InChIKey | URVIKCNNXASSER-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|