C8H12N2 — CID 68745640
1,2,3,4,7,8-hexahydro-1,5-naphthyridine (PubChem CID 68745640) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 1,2,3,4,7,8-hexahydro-1,5-naphthyridine.
| Compound Name | 1,2,3,4,7,8-hexahydro-1,5-naphthyridine |
|---|---|
| PubChem CID | 68745640 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 1,2,3,4,7,8-hexahydro-1,5-naphthyridine |
| SMILES | C1=NC2=C(CC1)NCCC2 |
| InChI | InChI=1S/C8H12N2/c1-3-7-8(9-5-1)4-2-6-10-7/h5,10H,1-4,6H2 |
| InChIKey | VQDDCHGYGKZHPH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |