About 4-(2,2-dimethylpiperidin-1-yl)-1-propylcyclohexa-2,4-dien-1-ol
4-(2,2-dimethylpiperidin-1-yl)-1-propylcyclohexa-2,4-dien-1-ol (PubChem CID 68745676) has the molecular formula C16H27NO
and a molecular weight of 249.40 g/mol. Its IUPAC name is 4-(2,2-dimethylpiperidin-1-yl)-1-propylcyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 4-(2,2-dimethylpiperidin-1-yl)-1-propylcyclohexa-2,4-dien-1-ol |
| PubChem CID | 68745676 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 4-(2,2-dimethylpiperidin-1-yl)-1-propylcyclohexa-2,4-dien-1-ol |
| SMILES | CCCC1(O)C=CC(N2CCCCC2(C)C)=CC1 |
| InChI | InChI=1S/C16H27NO/c1-4-9-16(18)11-7-14(8-12-16)17-13-6-5-10-15(17,2)3/h7-8,11,18H,4-6,9-10,12-13H2,1-3H3 |
| InChIKey | MSLGZAKUZNAGHK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2,2-dimethylpiperidin-1-yl)-1-propylcyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dimethylpiperidin-1-yl)-1-propylcyclohexa-2,4-dien-1-ol?
The IUPAC name of 4-(2,2-dimethylpiperidin-1-yl)-1-propylcyclohexa-2,4-dien-1-ol (CID 68745676) is 4-(2,2-dimethylpiperidin-1-yl)-1-propylcyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 4-(2,2-dimethylpiperidin-1-yl)-1-propylcyclohexa-2,4-dien-1-ol?
The canonical SMILES for 4-(2,2-dimethylpiperidin-1-yl)-1-propylcyclohexa-2,4-dien-1-ol is CCCC1(O)C=CC(N2CCCCC2(C)C)=CC1.
What is the InChIKey of 4-(2,2-dimethylpiperidin-1-yl)-1-propylcyclohexa-2,4-dien-1-ol?
The InChIKey is MSLGZAKUZNAGHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO/c1-4-9-16(18)11-7-14(8-12-16)17-13-6-5-10-15(17,2)3/h7-8,11,18H,4-6,9-10,12-13H2,1-3H3.
What are the key properties of 4-(2,2-dimethylpiperidin-1-yl)-1-propylcyclohexa-2,4-dien-1-ol?
4-(2,2-dimethylpiperidin-1-yl)-1-propylcyclohexa-2,4-dien-1-ol has a molecular weight of 249.40 g/mol, XLogP of 3.63, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethylpiperidin-1-yl)-1-propylcyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 68745676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).