C21H30N2O3 — CID 68746357
tert-butyl-[(3S,5S,6R)-6-methyl-1-(2-methylprop-2-enyl)-2-oxo-5-phenylpiperidin-3-yl]carbamic acid (PubChem CID 68746357) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is tert-butyl-[(3S,5S,6R)-6-methyl-1-(2-methylprop-2-enyl)-2-oxo-5-phenylpiperidin-3-yl]carbamic acid.
| Compound Name | tert-butyl-[(3S,5S,6R)-6-methyl-1-(2-methylprop-2-enyl)-2-oxo-5-phenylpiperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 68746357 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | tert-butyl-[(3S,5S,6R)-6-methyl-1-(2-methylprop-2-enyl)-2-oxo-5-phenylpiperidin-3-yl]carbamic acid |
| SMILES | C=C(C)CN1C(=O)[C@@H](N(C(=O)O)C(C)(C)C)C[C@@H](c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C21H30N2O3/c1-14(2)13-22-15(3)17(16-10-8-7-9-11-16)12-18(19(22)24)23(20(25)26)21(4,5)6/h7-11,15,17-18H,1,12-13H2,2-6H3,(H,25,26)/t15-,17-,18+/m1/s1 |
| InChIKey | LVIZYYNHQICXOC-NXHRZFHOSA-N |
| XLogP | 4.11 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|