C25H28N4O7 — CID 68746461
(4aS,5aR,12aS)-7-(dimethylamino)-2,3,10,12a-tetrahydroxy-9-(3-methylimidazol-4-yl)-1,11-dioxo-3,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide (PubChem CID 68746461) has the molecular formula C25H28N4O7 and a molecular weight of 496.52 g/mol. Its IUPAC name is (4aS,5aR,12aS)-7-(dimethylamino)-2,3,10,12a-tetrahydroxy-9-(3-methylimidazol-4-yl)-1,11-dioxo-3,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-7-(dimethylamino)-2,3,10,12a-tetrahydroxy-9-(3-methylimidazol-4-yl)-1,11-dioxo-3,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 68746461 |
| Molecular Formula | C25H28N4O7 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | (4aS,5aR,12aS)-7-(dimethylamino)-2,3,10,12a-tetrahydroxy-9-(3-methylimidazol-4-yl)-1,11-dioxo-3,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(-c2cncn2C)c(O)c2c1C[C@H]1C[C@H]3CC(O)C(O)(C(N)=O)C(=O)[C@@]3(O)C=C1C2=O |
| InChI | InChI=1S/C25H28N4O7/c1-28(2)16-7-14(17-9-27-10-29(17)3)20(31)19-13(16)5-11-4-12-6-18(30)25(36,23(26)34)22(33)24(12,35)8-15(11)21(19)32/h7-12,18,30-31,35-36H,4-6H2,1-3H3,(H2,26,34)/t11-,12+,18?,24-,25?/m1/s1 |
| InChIKey | MMGKIKPXAIXSIL-BNCLVMHGSA-N |
| XLogP | -0.56 |
| TPSA | 179.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|