C15H14FN3O3S — CID 68746857
1-[2-(2-fluorophenyl)-1-(furan-3-ylsulfonyl)imidazol-4-yl]-N-methylmethanamine (PubChem CID 68746857) has the molecular formula C15H14FN3O3S and a molecular weight of 335.36 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)-1-(furan-3-ylsulfonyl)imidazol-4-yl]-N-methylmethanamine.
| Compound Name | 1-[2-(2-fluorophenyl)-1-(furan-3-ylsulfonyl)imidazol-4-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 68746857 |
| Molecular Formula | C15H14FN3O3S |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 1-[2-(2-fluorophenyl)-1-(furan-3-ylsulfonyl)imidazol-4-yl]-N-methylmethanamine |
| SMILES | CNCc1cn(S(=O)(=O)c2ccoc2)c(-c2ccccc2F)n1 |
| InChI | InChI=1S/C15H14FN3O3S/c1-17-8-11-9-19(23(20,21)12-6-7-22-10-12)15(18-11)13-4-2-3-5-14(13)16/h2-7,9-10,17H,8H2,1H3 |
| InChIKey | MQPXEEGMTHIOMW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |