C23H31BrN2O2S — CID 68747088
(3S,4S,5R)-3-[(4-amino-3-bromophenyl)methyl]-5-[(3-tert-butylphenyl)methylamino]-1-oxothian-4-ol (PubChem CID 68747088) has the molecular formula C23H31BrN2O2S and a molecular weight of 479.48 g/mol. Its IUPAC name is (3S,4S,5R)-3-[(4-amino-3-bromophenyl)methyl]-5-[(3-tert-butylphenyl)methylamino]-1-oxothian-4-ol.
| Compound Name | (3S,4S,5R)-3-[(4-amino-3-bromophenyl)methyl]-5-[(3-tert-butylphenyl)methylamino]-1-oxothian-4-ol |
|---|---|
| PubChem CID | 68747088 |
| Molecular Formula | C23H31BrN2O2S |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | (3S,4S,5R)-3-[(4-amino-3-bromophenyl)methyl]-5-[(3-tert-butylphenyl)methylamino]-1-oxothian-4-ol |
| SMILES | CC(C)(C)c1cccc(CN[C@H]2CS(=O)C[C@@H](Cc3ccc(N)c(Br)c3)[C@@H]2O)c1 |
| InChI | InChI=1S/C23H31BrN2O2S/c1-23(2,3)18-6-4-5-16(10-18)12-26-21-14-29(28)13-17(22(21)27)9-15-7-8-20(25)19(24)11-15/h4-8,10-11,17,21-22,26-27H,9,12-14,25H2,1-3H3/t17-,21+,22+,29?/m1/s1 |
| InChIKey | VCGFGKZJCYYBEP-AGQDPHDRSA-N |
| XLogP | 3.77 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|