About 4-(2-methylpiperazin-1-yl)-1-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazine
4-(2-methylpiperazin-1-yl)-1-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazine (PubChem CID 68747460) has the molecular formula C19H18F3N5
and a molecular weight of 373.38 g/mol. Its IUPAC name is 4-(2-methylpiperazin-1-yl)-1-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazine.
Molecular Properties
| Compound Name | 4-(2-methylpiperazin-1-yl)-1-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazine |
| PubChem CID | 68747460 |
| Molecular Formula | C19H18F3N5 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 4-(2-methylpiperazin-1-yl)-1-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazine |
| SMILES | CC1CNCCN1c1nnc(-c2ccc(C(F)(F)F)cc2)c2ccncc12 |
| InChI | InChI=1S/C19H18F3N5/c1-12-10-24-8-9-27(12)18-16-11-23-7-6-15(16)17(25-26-18)13-2-4-14(5-3-13)19(20,21)22/h2-7,11-12,24H,8-10H2,1H3 |
| InChIKey | ZAUAJPWYYPQCRA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2-methylpiperazin-1-yl)-1-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylpiperazin-1-yl)-1-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazine?
The IUPAC name of 4-(2-methylpiperazin-1-yl)-1-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazine (CID 68747460) is 4-(2-methylpiperazin-1-yl)-1-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazine.
What is the SMILES notation for 4-(2-methylpiperazin-1-yl)-1-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazine?
The canonical SMILES for 4-(2-methylpiperazin-1-yl)-1-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazine is CC1CNCCN1c1nnc(-c2ccc(C(F)(F)F)cc2)c2ccncc12.
What is the InChIKey of 4-(2-methylpiperazin-1-yl)-1-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazine?
The InChIKey is ZAUAJPWYYPQCRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18F3N5/c1-12-10-24-8-9-27(12)18-16-11-23-7-6-15(16)17(25-26-18)13-2-4-14(5-3-13)19(20,21)22/h2-7,11-12,24H,8-10H2,1H3.
What are the key properties of 4-(2-methylpiperazin-1-yl)-1-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazine?
4-(2-methylpiperazin-1-yl)-1-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazine has a molecular weight of 373.38 g/mol, XLogP of 3.51, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylpiperazin-1-yl)-1-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazine is sourced from PubChem (CID 68747460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).