About pyridin-2-yl N-[[4-(1H-indol-5-yl)furan-2-yl]methyl]-N-(2-pyrrolidin-1-ylethyl)carbamate
pyridin-2-yl N-[[4-(1H-indol-5-yl)furan-2-yl]methyl]-N-(2-pyrrolidin-1-ylethyl)carbamate (PubChem CID 68748101) has the molecular formula C25H26N4O3
and a molecular weight of 430.51 g/mol. Its IUPAC name is pyridin-2-yl N-[[4-(1H-indol-5-yl)furan-2-yl]methyl]-N-(2-pyrrolidin-1-ylethyl)carbamate.
Molecular Properties
| Compound Name | pyridin-2-yl N-[[4-(1H-indol-5-yl)furan-2-yl]methyl]-N-(2-pyrrolidin-1-ylethyl)carbamate |
| PubChem CID | 68748101 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | pyridin-2-yl N-[[4-(1H-indol-5-yl)furan-2-yl]methyl]-N-(2-pyrrolidin-1-ylethyl)carbamate |
| SMILES | O=C(Oc1ccccn1)N(CCN1CCCC1)Cc1cc(-c2ccc3[nH]ccc3c2)co1 |
| InChI | InChI=1S/C25H26N4O3/c30-25(32-24-5-1-2-9-27-24)29(14-13-28-11-3-4-12-28)17-22-16-21(18-31-22)19-6-7-23-20(15-19)8-10-26-23/h1-2,5-10,15-16,18,26H,3-4,11-14,17H2 |
| InChIKey | UQHXSJBZVKEVKI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze pyridin-2-yl N-[[4-(1H-indol-5-yl)furan-2-yl]methyl]-N-(2-pyrrolidin-1-ylethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-yl N-[[4-(1H-indol-5-yl)furan-2-yl]methyl]-N-(2-pyrrolidin-1-ylethyl)carbamate?
The IUPAC name of pyridin-2-yl N-[[4-(1H-indol-5-yl)furan-2-yl]methyl]-N-(2-pyrrolidin-1-ylethyl)carbamate (CID 68748101) is pyridin-2-yl N-[[4-(1H-indol-5-yl)furan-2-yl]methyl]-N-(2-pyrrolidin-1-ylethyl)carbamate.
What is the SMILES notation for pyridin-2-yl N-[[4-(1H-indol-5-yl)furan-2-yl]methyl]-N-(2-pyrrolidin-1-ylethyl)carbamate?
The canonical SMILES for pyridin-2-yl N-[[4-(1H-indol-5-yl)furan-2-yl]methyl]-N-(2-pyrrolidin-1-ylethyl)carbamate is O=C(Oc1ccccn1)N(CCN1CCCC1)Cc1cc(-c2ccc3[nH]ccc3c2)co1.
What is the InChIKey of pyridin-2-yl N-[[4-(1H-indol-5-yl)furan-2-yl]methyl]-N-(2-pyrrolidin-1-ylethyl)carbamate?
The InChIKey is UQHXSJBZVKEVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26N4O3/c30-25(32-24-5-1-2-9-27-24)29(14-13-28-11-3-4-12-28)17-22-16-21(18-31-22)19-6-7-23-20(15-19)8-10-26-23/h1-2,5-10,15-16,18,26H,3-4,11-14,17H2.
What are the key properties of pyridin-2-yl N-[[4-(1H-indol-5-yl)furan-2-yl]methyl]-N-(2-pyrrolidin-1-ylethyl)carbamate?
pyridin-2-yl N-[[4-(1H-indol-5-yl)furan-2-yl]methyl]-N-(2-pyrrolidin-1-ylethyl)carbamate has a molecular weight of 430.51 g/mol, XLogP of 4.92, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-yl N-[[4-(1H-indol-5-yl)furan-2-yl]methyl]-N-(2-pyrrolidin-1-ylethyl)carbamate is sourced from PubChem (CID 68748101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).