C15H25N3O — CID 6874838
[(E)-2,2,5,9-tetramethyldeca-3,4,8-trienylideneamino]urea (PubChem CID 6874838) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is [(E)-2,2,5,9-tetramethyldeca-3,4,8-trienylideneamino]urea.
| Compound Name | [(E)-2,2,5,9-tetramethyldeca-3,4,8-trienylideneamino]urea |
|---|---|
| PubChem CID | 6874838 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | [(E)-2,2,5,9-tetramethyldeca-3,4,8-trienylideneamino]urea |
| SMILES | CC(=C=CC(C)(C)/C=N/NC(N)=O)CCC=C(C)C |
| InChI | InChI=1S/C15H25N3O/c1-12(2)7-6-8-13(3)9-10-15(4,5)11-17-18-14(16)19/h7,10-11H,6,8H2,1-5H3,(H3,16,18,19)/b17-11+ |
| InChIKey | AVWYELAWIMYOIQ-GZTJUZNOSA-N |
| XLogP | 3.51 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|