C21H18Cl2N2O2 — CID 68748456
4-[4-[[(2,6-dichlorophenyl)methylamino]methyl]phenoxy]benzamide (PubChem CID 68748456) has the molecular formula C21H18Cl2N2O2 and a molecular weight of 401.29 g/mol. Its IUPAC name is 4-[4-[[(2,6-dichlorophenyl)methylamino]methyl]phenoxy]benzamide.
| Compound Name | 4-[4-[[(2,6-dichlorophenyl)methylamino]methyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 68748456 |
| Molecular Formula | C21H18Cl2N2O2 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 4-[4-[[(2,6-dichlorophenyl)methylamino]methyl]phenoxy]benzamide |
| SMILES | NC(=O)c1ccc(Oc2ccc(CNCc3c(Cl)cccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C21H18Cl2N2O2/c22-19-2-1-3-20(23)18(19)13-25-12-14-4-8-16(9-5-14)27-17-10-6-15(7-11-17)21(24)26/h1-11,25H,12-13H2,(H2,24,26) |
| InChIKey | KOXIGTOGGYUAIC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |