C21H25BrFN3O2 — CID 68748478
tert-butyl 4-[(5-bromo-3-pyridinyl)methyl]-3-(4-fluorophenyl)piperazine-1-carboxylate (PubChem CID 68748478) has the molecular formula C21H25BrFN3O2 and a molecular weight of 450.35 g/mol. Its IUPAC name is tert-butyl 4-[(5-bromo-3-pyridinyl)methyl]-3-(4-fluorophenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(5-bromo-3-pyridinyl)methyl]-3-(4-fluorophenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 68748478 |
| Molecular Formula | C21H25BrFN3O2 |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | tert-butyl 4-[(5-bromo-3-pyridinyl)methyl]-3-(4-fluorophenyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2cncc(Br)c2)C(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H25BrFN3O2/c1-21(2,3)28-20(27)26-9-8-25(13-15-10-17(22)12-24-11-15)19(14-26)16-4-6-18(23)7-5-16/h4-7,10-12,19H,8-9,13-14H2,1-3H3 |
| InChIKey | JGKNIAROXFQYGJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |