C42H30Cl4N4 — CID 68748825
2-(1,4-dichlorocyclohexa-2,4-dien-1-yl)-2-[2-(1,4-dichlorocyclohexa-2,4-dien-1-yl)-4,5-diphenylimidazol-2-yl]-4,5-diphenylimidazole (PubChem CID 68748825) has the molecular formula C42H30Cl4N4 and a molecular weight of 732.54 g/mol. Its IUPAC name is 2-(1,4-dichlorocyclohexa-2,4-dien-1-yl)-2-[2-(1,4-dichlorocyclohexa-2,4-dien-1-yl)-4,5-diphenylimidazol-2-yl]-4,5-diphenylimidazole.
| Compound Name | 2-(1,4-dichlorocyclohexa-2,4-dien-1-yl)-2-[2-(1,4-dichlorocyclohexa-2,4-dien-1-yl)-4,5-diphenylimidazol-2-yl]-4,5-diphenylimidazole |
|---|---|
| PubChem CID | 68748825 |
| Molecular Formula | C42H30Cl4N4 |
| Molecular Weight | 732.54 g/mol |
| Exact Mass | 730.12 |
| IUPAC Name | 2-(1,4-dichlorocyclohexa-2,4-dien-1-yl)-2-[2-(1,4-dichlorocyclohexa-2,4-dien-1-yl)-4,5-diphenylimidazol-2-yl]-4,5-diphenylimidazole |
| SMILES | ClC1=CCC(Cl)(C2(C3(C4(Cl)C=CC(Cl)=CC4)N=C(c4ccccc4)C(c4ccccc4)=N3)N=C(c3ccccc3)C(c3ccccc3)=N2)C=C1 |
| InChI | InChI=1S/C42H30Cl4N4/c43-33-21-25-39(45,26-22-33)41(47-35(29-13-5-1-6-14-29)36(48-41)30-15-7-2-8-16-30)42(40(46)27-23-34(44)24-28-40)49-37(31-17-9-3-10-18-31)38(50-42)32-19-11-4-12-20-32/h1-25,27H,26,28H2 |
| InChIKey | MPJRLYRHGAOISH-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.54 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|