C11H14N2O2 — CID 68749271
[(7S)-7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]urea (PubChem CID 68749271) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is [(7S)-7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]urea.
| Compound Name | [(7S)-7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]urea |
|---|---|
| PubChem CID | 68749271 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | [(7S)-7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]urea |
| SMILES | NC(=O)Nc1cccc2c1C[C@@H](O)CC2 |
| InChI | InChI=1S/C11H14N2O2/c12-11(15)13-10-3-1-2-7-4-5-8(14)6-9(7)10/h1-3,8,14H,4-6H2,(H3,12,13,15)/t8-/m0/s1 |
| InChIKey | NMKHNUDOLHJLRH-QMMMGPOBSA-N |
| XLogP | 1.03 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |