C41H36N4O5 — CID 68749303
3-[5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-2,4-bis(phenylmethoxy)phenyl]-4-(1-methylindol-5-yl)-1H-1,2,4-triazol-5-one (PubChem CID 68749303) has the molecular formula C41H36N4O5 and a molecular weight of 664.76 g/mol. Its IUPAC name is 3-[5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-2,4-bis(phenylmethoxy)phenyl]-4-(1-methylindol-5-yl)-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-2,4-bis(phenylmethoxy)phenyl]-4-(1-methylindol-5-yl)-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 68749303 |
| Molecular Formula | C41H36N4O5 |
| Molecular Weight | 664.76 g/mol |
| Exact Mass | 664.27 |
| IUPAC Name | 3-[5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-2,4-bis(phenylmethoxy)phenyl]-4-(1-methylindol-5-yl)-1H-1,2,4-triazol-5-one |
| SMILES | COc1ccc(/C=C/c2cc(-c3n[nH]c(=O)n3-c3ccc4c(ccn4C)c3)c(OCc3ccccc3)cc2OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C41H36N4O5/c1-44-21-20-31-23-33(17-18-35(31)44)45-40(42-43-41(45)46)34-24-32(16-14-28-15-19-36(47-2)39(22-28)48-3)37(49-26-29-10-6-4-7-11-29)25-38(34)50-27-30-12-8-5-9-13-30/h4-25H,26-27H2,1-3H3,(H,43,46)/b16-14+ |
| InChIKey | IOYSTQUJBULAKX-JQIJEIRASA-N |
| XLogP | 8.06 |
| TPSA | 92.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.76 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|