C31H36Cl2N4O6 — CID 68750045
ethyl 2-[[2-[4-[1-chloro-2-(4-chlorophenyl)ethyl]-1-(2-methoxyethyl)-3,6-dioxopiperazin-2-yl]acetyl]-[2-(1H-indol-3-yl)ethyl]amino]acetate (PubChem CID 68750045) has the molecular formula C31H36Cl2N4O6 and a molecular weight of 631.56 g/mol. Its IUPAC name is ethyl 2-[[2-[4-[1-chloro-2-(4-chlorophenyl)ethyl]-1-(2-methoxyethyl)-3,6-dioxopiperazin-2-yl]acetyl]-[2-(1H-indol-3-yl)ethyl]amino]acetate.
| Compound Name | ethyl 2-[[2-[4-[1-chloro-2-(4-chlorophenyl)ethyl]-1-(2-methoxyethyl)-3,6-dioxopiperazin-2-yl]acetyl]-[2-(1H-indol-3-yl)ethyl]amino]acetate |
|---|---|
| PubChem CID | 68750045 |
| Molecular Formula | C31H36Cl2N4O6 |
| Molecular Weight | 631.56 g/mol |
| Exact Mass | 630.20 |
| IUPAC Name | ethyl 2-[[2-[4-[1-chloro-2-(4-chlorophenyl)ethyl]-1-(2-methoxyethyl)-3,6-dioxopiperazin-2-yl]acetyl]-[2-(1H-indol-3-yl)ethyl]amino]acetate |
| SMILES | CCOC(=O)CN(CCc1c[nH]c2ccccc12)C(=O)CC1C(=O)N(C(Cl)Cc2ccc(Cl)cc2)CC(=O)N1CCOC |
| InChI | InChI=1S/C31H36Cl2N4O6/c1-3-43-30(40)20-35(13-12-22-18-34-25-7-5-4-6-24(22)25)28(38)17-26-31(41)37(19-29(39)36(26)14-15-42-2)27(33)16-21-8-10-23(32)11-9-21/h4-11,18,26-27,34H,3,12-17,19-20H2,1-2H3 |
| InChIKey | DQMJQUJJHAWKRN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.56 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|