C28H28F3N3O5 — CID 68750070
3-[[3-methyl-2-[(2-oxo-2-phenylacetyl)amino]pentanoyl]amino]-8-(trifluoromethyl)-1,2,4,9-tetrahydrocarbazole-3-carboxylic acid (PubChem CID 68750070) has the molecular formula C28H28F3N3O5 and a molecular weight of 543.54 g/mol. Its IUPAC name is 3-[[3-methyl-2-[(2-oxo-2-phenylacetyl)amino]pentanoyl]amino]-8-(trifluoromethyl)-1,2,4,9-tetrahydrocarbazole-3-carboxylic acid.
| Compound Name | 3-[[3-methyl-2-[(2-oxo-2-phenylacetyl)amino]pentanoyl]amino]-8-(trifluoromethyl)-1,2,4,9-tetrahydrocarbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 68750070 |
| Molecular Formula | C28H28F3N3O5 |
| Molecular Weight | 543.54 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | 3-[[3-methyl-2-[(2-oxo-2-phenylacetyl)amino]pentanoyl]amino]-8-(trifluoromethyl)-1,2,4,9-tetrahydrocarbazole-3-carboxylic acid |
| SMILES | CCC(C)C(NC(=O)C(=O)c1ccccc1)C(=O)NC1(C(=O)O)CCc2[nH]c3c(C(F)(F)F)cccc3c2C1 |
| InChI | InChI=1S/C28H28F3N3O5/c1-3-15(2)21(33-25(37)23(35)16-8-5-4-6-9-16)24(36)34-27(26(38)39)13-12-20-18(14-27)17-10-7-11-19(22(17)32-20)28(29,30)31/h4-11,15,21,32H,3,12-14H2,1-2H3,(H,33,37)(H,34,36)(H,38,39) |
| InChIKey | MKAPLRMNHNKRNZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|