C19H19N3O2S2 — CID 68750453
2-[5-(3-methylsulfonylphenyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-4-yl]aniline (PubChem CID 68750453) has the molecular formula C19H19N3O2S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-[5-(3-methylsulfonylphenyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-4-yl]aniline.
| Compound Name | 2-[5-(3-methylsulfonylphenyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-4-yl]aniline |
|---|---|
| PubChem CID | 68750453 |
| Molecular Formula | C19H19N3O2S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 2-[5-(3-methylsulfonylphenyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-4-yl]aniline |
| SMILES | CS(=O)(=O)c1cccc(N2CCc3ncsc3C2c2ccccc2N)c1 |
| InChI | InChI=1S/C19H19N3O2S2/c1-26(23,24)14-6-4-5-13(11-14)22-10-9-17-19(25-12-21-17)18(22)15-7-2-3-8-16(15)20/h2-8,11-12,18H,9-10,20H2,1H3 |
| InChIKey | RXHWVOAHPAGTEH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|