About 7-nitro-2,3-dihydroimidazo[2,1-b][1,3]benzothiazin-5-one
7-nitro-2,3-dihydroimidazo[2,1-b][1,3]benzothiazin-5-one (PubChem CID 687505) has the molecular formula C10H7N3O3S
and a molecular weight of 249.25 g/mol. Its IUPAC name is 7-nitro-2,3-dihydroimidazo[2,1-b][1,3]benzothiazin-5-one.
Molecular Properties
| Compound Name | 7-nitro-2,3-dihydroimidazo[2,1-b][1,3]benzothiazin-5-one |
| PubChem CID | 687505 |
| Molecular Formula | C10H7N3O3S |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 7-nitro-2,3-dihydroimidazo[2,1-b][1,3]benzothiazin-5-one |
| SMILES | O=C1c2cc([N+](=O)[O-])ccc2SC2=NCCN12 |
| InChI | InChI=1S/C10H7N3O3S/c14-9-7-5-6(13(15)16)1-2-8(7)17-10-11-3-4-12(9)10/h1-2,5H,3-4H2 |
| InChIKey | HNVAZHADJCCCSV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-nitro-2,3-dihydroimidazo[2,1-b][1,3]benzothiazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-nitro-2,3-dihydroimidazo[2,1-b][1,3]benzothiazin-5-one?
The IUPAC name of 7-nitro-2,3-dihydroimidazo[2,1-b][1,3]benzothiazin-5-one (CID 687505) is 7-nitro-2,3-dihydroimidazo[2,1-b][1,3]benzothiazin-5-one.
What is the SMILES notation for 7-nitro-2,3-dihydroimidazo[2,1-b][1,3]benzothiazin-5-one?
The canonical SMILES for 7-nitro-2,3-dihydroimidazo[2,1-b][1,3]benzothiazin-5-one is O=C1c2cc([N+](=O)[O-])ccc2SC2=NCCN12.
What is the InChIKey of 7-nitro-2,3-dihydroimidazo[2,1-b][1,3]benzothiazin-5-one?
The InChIKey is HNVAZHADJCCCSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3O3S/c14-9-7-5-6(13(15)16)1-2-8(7)17-10-11-3-4-12(9)10/h1-2,5H,3-4H2.
What are the key properties of 7-nitro-2,3-dihydroimidazo[2,1-b][1,3]benzothiazin-5-one?
7-nitro-2,3-dihydroimidazo[2,1-b][1,3]benzothiazin-5-one has a molecular weight of 249.25 g/mol, XLogP of 1.51, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitro-2,3-dihydroimidazo[2,1-b][1,3]benzothiazin-5-one is sourced from PubChem (CID 687505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).