C36H32O6 — CID 68750612
methyl 3,3,6-tris(4-methoxyphenyl)-2,4-dihydrobenzo[h]chromene-5-carboxylate (PubChem CID 68750612) has the molecular formula C36H32O6 and a molecular weight of 560.65 g/mol. Its IUPAC name is methyl 3,3,6-tris(4-methoxyphenyl)-2,4-dihydrobenzo[h]chromene-5-carboxylate.
| Compound Name | methyl 3,3,6-tris(4-methoxyphenyl)-2,4-dihydrobenzo[h]chromene-5-carboxylate |
|---|---|
| PubChem CID | 68750612 |
| Molecular Formula | C36H32O6 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | methyl 3,3,6-tris(4-methoxyphenyl)-2,4-dihydrobenzo[h]chromene-5-carboxylate |
| SMILES | COC(=O)c1c2c(c3ccccc3c1-c1ccc(OC)cc1)OCC(c1ccc(OC)cc1)(c1ccc(OC)cc1)C2 |
| InChI | InChI=1S/C36H32O6/c1-38-26-15-9-23(10-16-26)32-29-7-5-6-8-30(29)34-31(33(32)35(37)41-4)21-36(22-42-34,24-11-17-27(39-2)18-12-24)25-13-19-28(40-3)20-14-25/h5-20H,21-22H2,1-4H3 |
| InChIKey | QBQDMZGGPDHFHQ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |