C10H8F3N2O2+ — CID 68750675
2-hydroxy-1-(2,2,2-trifluoroethyl)pyrido[1,2-a]pyrimidin-1-ium-4-one (PubChem CID 68750675) has the molecular formula C10H8F3N2O2+ and a molecular weight of 245.18 g/mol. Its IUPAC name is 2-hydroxy-1-(2,2,2-trifluoroethyl)pyrido[1,2-a]pyrimidin-1-ium-4-one.
| Compound Name | 2-hydroxy-1-(2,2,2-trifluoroethyl)pyrido[1,2-a]pyrimidin-1-ium-4-one |
|---|---|
| PubChem CID | 68750675 |
| Molecular Formula | C10H8F3N2O2+ |
| Molecular Weight | 245.18 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-hydroxy-1-(2,2,2-trifluoroethyl)pyrido[1,2-a]pyrimidin-1-ium-4-one |
| SMILES | O=c1cc(O)[n+](CC(F)(F)F)c2ccccn12 |
| InChI | InChI=1S/C10H7F3N2O2/c11-10(12,13)6-15-7-3-1-2-4-14(7)8(16)5-9(15)17/h1-5H,6H2/p+1 |
| InChIKey | MPIVWRUOXCGJOC-UHFFFAOYSA-O |
| XLogP | 0.85 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.18 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|