C20H38O4Si — CID 68750706
(1S,2R,3S,4R)-3-[[dimethyl(2-methylpropyl)silyl]oxymethyl]-4-(oxan-2-yloxy)-2-prop-2-enylcyclopentan-1-ol (PubChem CID 68750706) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is (1S,2R,3S,4R)-3-[[dimethyl(2-methylpropyl)silyl]oxymethyl]-4-(oxan-2-yloxy)-2-prop-2-enylcyclopentan-1-ol.
| Compound Name | (1S,2R,3S,4R)-3-[[dimethyl(2-methylpropyl)silyl]oxymethyl]-4-(oxan-2-yloxy)-2-prop-2-enylcyclopentan-1-ol |
|---|---|
| PubChem CID | 68750706 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (1S,2R,3S,4R)-3-[[dimethyl(2-methylpropyl)silyl]oxymethyl]-4-(oxan-2-yloxy)-2-prop-2-enylcyclopentan-1-ol |
| SMILES | C=CC[C@@H]1[C@@H](CO[Si](C)(C)CC(C)C)[C@H](OC2CCCCO2)C[C@@H]1O |
| InChI | InChI=1S/C20H38O4Si/c1-6-9-16-17(13-23-25(4,5)14-15(2)3)19(12-18(16)21)24-20-10-7-8-11-22-20/h6,15-21H,1,7-14H2,2-5H3/t16-,17-,18+,19-,20?/m1/s1 |
| InChIKey | LAVWPHDZCYXWDA-QUIYGKKVSA-N |
| XLogP | 4.35 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|