C18H18F2N4O2 — CID 68750794
(3-amino-2,6-difluorophenyl)-(5-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanol (PubChem CID 68750794) has the molecular formula C18H18F2N4O2 and a molecular weight of 360.36 g/mol. Its IUPAC name is (3-amino-2,6-difluorophenyl)-(5-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanol.
| Compound Name | (3-amino-2,6-difluorophenyl)-(5-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanol |
|---|---|
| PubChem CID | 68750794 |
| Molecular Formula | C18H18F2N4O2 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (3-amino-2,6-difluorophenyl)-(5-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanol |
| SMILES | Nc1ccc(F)c(C(O)c2c[nH]c3ncc(N4CCOCC4)cc23)c1F |
| InChI | InChI=1S/C18H18F2N4O2/c19-13-1-2-14(21)16(20)15(13)17(25)12-9-23-18-11(12)7-10(8-22-18)24-3-5-26-6-4-24/h1-2,7-9,17,25H,3-6,21H2,(H,22,23) |
| InChIKey | BZFLFKXZMYKMGK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|