C13H10N4O2 — CID 68750998
4-(1-oxo-2H-pyrrolo[1,2-d][1,2,4]triazin-4-yl)benzamide (PubChem CID 68750998) has the molecular formula C13H10N4O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is 4-(1-oxo-2H-pyrrolo[1,2-d][1,2,4]triazin-4-yl)benzamide.
| Compound Name | 4-(1-oxo-2H-pyrrolo[1,2-d][1,2,4]triazin-4-yl)benzamide |
|---|---|
| PubChem CID | 68750998 |
| Molecular Formula | C13H10N4O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 4-(1-oxo-2H-pyrrolo[1,2-d][1,2,4]triazin-4-yl)benzamide |
| SMILES | NC(=O)c1ccc(-c2n[nH]c(=O)c3cccn23)cc1 |
| InChI | InChI=1S/C13H10N4O2/c14-11(18)8-3-5-9(6-4-8)12-15-16-13(19)10-2-1-7-17(10)12/h1-7H,(H2,14,18)(H,16,19) |
| InChIKey | QQCGQHXTMJTFRO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |