About 2-fluoro-1,3-thiazol-5-amine
2-fluoro-1,3-thiazol-5-amine (PubChem CID 68751306) has the molecular formula C3H3FN2S
and a molecular weight of 118.14 g/mol. Its IUPAC name is 2-fluoro-1,3-thiazol-5-amine.
Molecular Properties
| Compound Name | 2-fluoro-1,3-thiazol-5-amine |
| PubChem CID | 68751306 |
| Molecular Formula | C3H3FN2S |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.00 |
| IUPAC Name | 2-fluoro-1,3-thiazol-5-amine |
| SMILES | Nc1cnc(F)s1 |
| InChI | InChI=1S/C3H3FN2S/c4-3-6-1-2(5)7-3/h1H,5H2 |
| InChIKey | AVFOXWWYXPGFSI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-1,3-thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1,3-thiazol-5-amine?
The IUPAC name of 2-fluoro-1,3-thiazol-5-amine (CID 68751306) is 2-fluoro-1,3-thiazol-5-amine.
What is the SMILES notation for 2-fluoro-1,3-thiazol-5-amine?
The canonical SMILES for 2-fluoro-1,3-thiazol-5-amine is Nc1cnc(F)s1.
What is the InChIKey of 2-fluoro-1,3-thiazol-5-amine?
The InChIKey is AVFOXWWYXPGFSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3FN2S/c4-3-6-1-2(5)7-3/h1H,5H2.
What are the key properties of 2-fluoro-1,3-thiazol-5-amine?
2-fluoro-1,3-thiazol-5-amine has a molecular weight of 118.14 g/mol, XLogP of 0.86, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1,3-thiazol-5-amine is sourced from PubChem (CID 68751306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).