C18H17BFN3O5 — CID 68751355
[6-[4-(N-ethoxycarbonyl-2-fluoroanilino)-3-methyl-1,2-oxazol-5-yl]-3-pyridinyl]boronic acid (PubChem CID 68751355) has the molecular formula C18H17BFN3O5 and a molecular weight of 385.16 g/mol. Its IUPAC name is [6-[4-(N-ethoxycarbonyl-2-fluoroanilino)-3-methyl-1,2-oxazol-5-yl]-3-pyridinyl]boronic acid.
| Compound Name | [6-[4-(N-ethoxycarbonyl-2-fluoroanilino)-3-methyl-1,2-oxazol-5-yl]-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 68751355 |
| Molecular Formula | C18H17BFN3O5 |
| Molecular Weight | 385.16 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | [6-[4-(N-ethoxycarbonyl-2-fluoroanilino)-3-methyl-1,2-oxazol-5-yl]-3-pyridinyl]boronic acid |
| SMILES | CCOC(=O)N(c1ccccc1F)c1c(C)noc1-c1ccc(B(O)O)cn1 |
| InChI | InChI=1S/C18H17BFN3O5/c1-3-27-18(24)23(15-7-5-4-6-13(15)20)16-11(2)22-28-17(16)14-9-8-12(10-21-14)19(25)26/h4-10,25-26H,3H2,1-2H3 |
| InChIKey | XHEYSDBRIRRNJR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.16 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|