About [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl carbamate
[4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl carbamate (PubChem CID 68751779) has the molecular formula C23H16N4O2
and a molecular weight of 380.41 g/mol. Its IUPAC name is [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl carbamate.
Molecular Properties
| Compound Name | [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl carbamate |
| PubChem CID | 68751779 |
| Molecular Formula | C23H16N4O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl carbamate |
| SMILES | N#Cc1nccc2nc(-c3ccc(COC(N)=O)cc3)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C23H16N4O2/c24-13-21-19-12-18(16-4-2-1-3-5-16)22(27-20(19)10-11-26-21)17-8-6-15(7-9-17)14-29-23(25)28/h1-12H,14H2,(H2,25,28) |
| InChIKey | XIJHDRNVLOWLDJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl carbamate?
The IUPAC name of [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl carbamate (CID 68751779) is [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl carbamate.
What is the SMILES notation for [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl carbamate?
The canonical SMILES for [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl carbamate is N#Cc1nccc2nc(-c3ccc(COC(N)=O)cc3)c(-c3ccccc3)cc12.
What is the InChIKey of [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl carbamate?
The InChIKey is XIJHDRNVLOWLDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N4O2/c24-13-21-19-12-18(16-4-2-1-3-5-16)22(27-20(19)10-11-26-21)17-8-6-15(7-9-17)14-29-23(25)28/h1-12H,14H2,(H2,25,28).
What are the key properties of [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl carbamate?
[4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl carbamate has a molecular weight of 380.41 g/mol, XLogP of 4.43, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl carbamate is sourced from PubChem (CID 68751779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).