About 3-fluoro-2,5-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]-1H-pyrazole-5-carboxamide
3-fluoro-2,5-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]-1H-pyrazole-5-carboxamide (PubChem CID 68752292) has the molecular formula C18H26FN3O
and a molecular weight of 319.42 g/mol. Its IUPAC name is 3-fluoro-2,5-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]-1H-pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-fluoro-2,5-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]-1H-pyrazole-5-carboxamide |
| PubChem CID | 68752292 |
| Molecular Formula | C18H26FN3O |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 3-fluoro-2,5-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]-1H-pyrazole-5-carboxamide |
| SMILES | CC(C)CC(C)c1ccccc1NC(=O)C1(C)C=C(F)N(C)N1 |
| InChI | InChI=1S/C18H26FN3O/c1-12(2)10-13(3)14-8-6-7-9-15(14)20-17(23)18(4)11-16(19)22(5)21-18/h6-9,11-13,21H,10H2,1-5H3,(H,20,23) |
| InChIKey | FXAVGWZRNRMGPS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-2,5-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]-1H-pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2,5-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]-1H-pyrazole-5-carboxamide?
The IUPAC name of 3-fluoro-2,5-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]-1H-pyrazole-5-carboxamide (CID 68752292) is 3-fluoro-2,5-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]-1H-pyrazole-5-carboxamide.
What is the SMILES notation for 3-fluoro-2,5-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]-1H-pyrazole-5-carboxamide?
The canonical SMILES for 3-fluoro-2,5-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]-1H-pyrazole-5-carboxamide is CC(C)CC(C)c1ccccc1NC(=O)C1(C)C=C(F)N(C)N1.
What is the InChIKey of 3-fluoro-2,5-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]-1H-pyrazole-5-carboxamide?
The InChIKey is FXAVGWZRNRMGPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26FN3O/c1-12(2)10-13(3)14-8-6-7-9-15(14)20-17(23)18(4)11-16(19)22(5)21-18/h6-9,11-13,21H,10H2,1-5H3,(H,20,23).
What are the key properties of 3-fluoro-2,5-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]-1H-pyrazole-5-carboxamide?
3-fluoro-2,5-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]-1H-pyrazole-5-carboxamide has a molecular weight of 319.42 g/mol, XLogP of 3.79, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2,5-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]-1H-pyrazole-5-carboxamide is sourced from PubChem (CID 68752292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).