About pyrimidin-2-yl N-[[2-fluoro-5-(1H-indol-5-yl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)carbamate
pyrimidin-2-yl N-[[2-fluoro-5-(1H-indol-5-yl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)carbamate (PubChem CID 68752511) has the molecular formula C26H26FN5O2
and a molecular weight of 459.53 g/mol. Its IUPAC name is pyrimidin-2-yl N-[[2-fluoro-5-(1H-indol-5-yl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)carbamate.
Molecular Properties
| Compound Name | pyrimidin-2-yl N-[[2-fluoro-5-(1H-indol-5-yl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)carbamate |
| PubChem CID | 68752511 |
| Molecular Formula | C26H26FN5O2 |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | pyrimidin-2-yl N-[[2-fluoro-5-(1H-indol-5-yl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)carbamate |
| SMILES | CN1CCC(N(Cc2cc(-c3ccc4[nH]ccc4c3)ccc2F)C(=O)Oc2ncccn2)CC1 |
| InChI | InChI=1S/C26H26FN5O2/c1-31-13-8-22(9-14-31)32(26(33)34-25-29-10-2-11-30-25)17-21-16-18(3-5-23(21)27)19-4-6-24-20(15-19)7-12-28-24/h2-7,10-12,15-16,22,28H,8-9,13-14,17H2,1H3 |
| InChIKey | GZVSXWSELYEJHX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze pyrimidin-2-yl N-[[2-fluoro-5-(1H-indol-5-yl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimidin-2-yl N-[[2-fluoro-5-(1H-indol-5-yl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)carbamate?
The IUPAC name of pyrimidin-2-yl N-[[2-fluoro-5-(1H-indol-5-yl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)carbamate (CID 68752511) is pyrimidin-2-yl N-[[2-fluoro-5-(1H-indol-5-yl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)carbamate.
What is the SMILES notation for pyrimidin-2-yl N-[[2-fluoro-5-(1H-indol-5-yl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)carbamate?
The canonical SMILES for pyrimidin-2-yl N-[[2-fluoro-5-(1H-indol-5-yl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)carbamate is CN1CCC(N(Cc2cc(-c3ccc4[nH]ccc4c3)ccc2F)C(=O)Oc2ncccn2)CC1.
What is the InChIKey of pyrimidin-2-yl N-[[2-fluoro-5-(1H-indol-5-yl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)carbamate?
The InChIKey is GZVSXWSELYEJHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26FN5O2/c1-31-13-8-22(9-14-31)32(26(33)34-25-29-10-2-11-30-25)17-21-16-18(3-5-23(21)27)19-4-6-24-20(15-19)7-12-28-24/h2-7,10-12,15-16,22,28H,8-9,13-14,17H2,1H3.
What are the key properties of pyrimidin-2-yl N-[[2-fluoro-5-(1H-indol-5-yl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)carbamate?
pyrimidin-2-yl N-[[2-fluoro-5-(1H-indol-5-yl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)carbamate has a molecular weight of 459.53 g/mol, XLogP of 4.86, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimidin-2-yl N-[[2-fluoro-5-(1H-indol-5-yl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)carbamate is sourced from PubChem (CID 68752511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).