1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid

C13H19F2NO3 — CID 68752659

IUPAC1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid
SMILESO=C(O)C1CCCN(C(=O)C2CCC(F)(F)CC2)C1
InChIInChI=1S/C13H19F2NO3/c14-13(15)5-3-9(4-6-13)11(17)16-7-1-2-10(8-16)12(18)19/h9-10H,1-8H2,(H,18,19)
InChIKeyYWIZZMSJBLRETA-UHFFFAOYSA-N
MW275.29 g/mol
LogP2.14
Rot. Bonds2

About 1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid

1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid (PubChem CID 68752659) has the molecular formula C13H19F2NO3 and a molecular weight of 275.29 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid.

Molecular Properties

Compound Name1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid
PubChem CID68752659
Molecular FormulaC13H19F2NO3
Molecular Weight275.29 g/mol
Exact Mass275.13
IUPAC Name1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid
SMILESO=C(O)C1CCCN(C(=O)C2CCC(F)(F)CC2)C1
InChIInChI=1S/C13H19F2NO3/c14-13(15)5-3-9(4-6-13)11(17)16-7-1-2-10(8-16)12(18)19/h9-10H,1-8H2,(H,18,19)
InChIKeyYWIZZMSJBLRETA-UHFFFAOYSA-N
XLogP2.14
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.29
LogP ≤ 52.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid?
The IUPAC name of 1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid (CID 68752659) is 1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid.
What is the SMILES notation for 1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid?
The canonical SMILES for 1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid is O=C(O)C1CCCN(C(=O)C2CCC(F)(F)CC2)C1.
What is the InChIKey of 1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid?
The InChIKey is YWIZZMSJBLRETA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F2NO3/c14-13(15)5-3-9(4-6-13)11(17)16-7-1-2-10(8-16)12(18)19/h9-10H,1-8H2,(H,18,19).
What are the key properties of 1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid?
1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid has a molecular weight of 275.29 g/mol, XLogP of 2.14, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-difluorocyclohexanecarbonyl)piperidine-3-carboxylic acid is sourced from PubChem (CID 68752659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).