C27H31N7O2Si — CID 68752734
7-cyclopropyl-2-N-[3-pyridin-4-yl-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]furo[3,2-d]pyrimidine-2,4-diamine (PubChem CID 68752734) has the molecular formula C27H31N7O2Si and a molecular weight of 513.68 g/mol. Its IUPAC name is 7-cyclopropyl-2-N-[3-pyridin-4-yl-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]furo[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 7-cyclopropyl-2-N-[3-pyridin-4-yl-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]furo[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68752734 |
| Molecular Formula | C27H31N7O2Si |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 7-cyclopropyl-2-N-[3-pyridin-4-yl-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]furo[3,2-d]pyrimidine-2,4-diamine |
| SMILES | C[Si](C)(C)CCOCn1nc(-c2ccncc2)c2ccc(Nc3nc(N)c4occ(C5CC5)c4n3)cc21 |
| InChI | InChI=1S/C27H31N7O2Si/c1-37(2,3)13-12-35-16-34-22-14-19(6-7-20(22)23(33-34)18-8-10-29-11-9-18)30-27-31-24-21(17-4-5-17)15-36-25(24)26(28)32-27/h6-11,14-15,17H,4-5,12-13,16H2,1-3H3,(H3,28,30,31,32) |
| InChIKey | HUUDIOHFCSFJND-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|