C22H28ClFO7 — CID 68753304
2-[[(3R,5aR,6R,7R,8aS)-6-[(3R)-4-(3-chloro-4-fluorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]methoxy]acetic acid (PubChem CID 68753304) has the molecular formula C22H28ClFO7 and a molecular weight of 458.91 g/mol. Its IUPAC name is 2-[[(3R,5aR,6R,7R,8aS)-6-[(3R)-4-(3-chloro-4-fluorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]methoxy]acetic acid.
| Compound Name | 2-[[(3R,5aR,6R,7R,8aS)-6-[(3R)-4-(3-chloro-4-fluorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]methoxy]acetic acid |
|---|---|
| PubChem CID | 68753304 |
| Molecular Formula | C22H28ClFO7 |
| Molecular Weight | 458.91 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 2-[[(3R,5aR,6R,7R,8aS)-6-[(3R)-4-(3-chloro-4-fluorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]methoxy]acetic acid |
| SMILES | O=C(O)COC[C@H]1CC[C@@H]2[C@@H](C=C[C@@H](O)COc3ccc(F)c(Cl)c3)[C@H](O)C[C@@H]2OC1 |
| InChI | InChI=1S/C22H28ClFO7/c23-18-7-15(3-6-19(18)24)30-11-14(25)2-5-16-17-4-1-13(9-29-12-22(27)28)10-31-21(17)8-20(16)26/h2-3,5-7,13-14,16-17,20-21,25-26H,1,4,8-12H2,(H,27,28)/t13-,14-,16-,17-,20-,21+/m1/s1 |
| InChIKey | BBXNSNFJUAIXFG-LMVGYPHNSA-N |
| XLogP | 2.67 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.91 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|