C26H28N2O2 — CID 68753671
(8R,9S,10R,13S,14S)-17-(1H-benzimidazol-2-yl)-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene-3,6-dione (PubChem CID 68753671) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-17-(1H-benzimidazol-2-yl)-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene-3,6-dione.
| Compound Name | (8R,9S,10R,13S,14S)-17-(1H-benzimidazol-2-yl)-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene-3,6-dione |
|---|---|
| PubChem CID | 68753671 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (8R,9S,10R,13S,14S)-17-(1H-benzimidazol-2-yl)-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene-3,6-dione |
| SMILES | C[C@]12CCC(=O)C=C1C(=O)C[C@@H]1[C@@H]2CC[C@]2(C)C(c3nc4ccccc4[nH]3)=CC[C@@H]12 |
| InChI | InChI=1S/C26H28N2O2/c1-25-12-10-18-16(14-23(30)20-13-15(29)9-11-26(18,20)2)17(25)7-8-19(25)24-27-21-5-3-4-6-22(21)28-24/h3-6,8,13,16-18H,7,9-12,14H2,1-2H3,(H,27,28)/t16-,17-,18-,25-,26+/m0/s1 |
| InChIKey | UNFBBYHTURYPMP-XRGACPPHSA-N |
| XLogP | 5.27 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |