About 1-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-3-ethylthiourea
1-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-3-ethylthiourea (PubChem CID 6875391) has the molecular formula C11H13Br2N3OS
and a molecular weight of 395.12 g/mol. Its IUPAC name is 1-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-3-ethylthiourea.
Molecular Properties
| Compound Name | 1-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-3-ethylthiourea |
| PubChem CID | 6875391 |
| Molecular Formula | C11H13Br2N3OS |
| Molecular Weight | 395.12 g/mol |
| Exact Mass | 392.91 |
| IUPAC Name | 1-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-3-ethylthiourea |
| SMILES | CCNC(=S)N/N=C/c1cc(Br)cc(Br)c1OC |
| InChI | InChI=1S/C11H13Br2N3OS/c1-3-14-11(18)16-15-6-7-4-8(12)5-9(13)10(7)17-2/h4-6H,3H2,1-2H3,(H2,14,16,18)/b15-6+ |
| InChIKey | HMRIGSYVGFSWIH-GIDUJCDVSA-N |
| XLogP | 3.04 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.12 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-3-ethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-3-ethylthiourea?
The IUPAC name of 1-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-3-ethylthiourea (CID 6875391) is 1-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-3-ethylthiourea.
What is the SMILES notation for 1-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-3-ethylthiourea?
The canonical SMILES for 1-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-3-ethylthiourea is CCNC(=S)N/N=C/c1cc(Br)cc(Br)c1OC.
What is the InChIKey of 1-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-3-ethylthiourea?
The InChIKey is HMRIGSYVGFSWIH-GIDUJCDVSA-N. The full InChI is InChI=1S/C11H13Br2N3OS/c1-3-14-11(18)16-15-6-7-4-8(12)5-9(13)10(7)17-2/h4-6H,3H2,1-2H3,(H2,14,16,18)/b15-6+.
What are the key properties of 1-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-3-ethylthiourea?
1-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-3-ethylthiourea has a molecular weight of 395.12 g/mol, XLogP of 3.04, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-3-ethylthiourea is sourced from PubChem (CID 6875391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).