C8H10F3N3O4 — CID 68754048
[1-amino-2-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]ethyl] 2,2,2-trifluoroacetate (PubChem CID 68754048) has the molecular formula C8H10F3N3O4 and a molecular weight of 269.18 g/mol. Its IUPAC name is [1-amino-2-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]ethyl] 2,2,2-trifluoroacetate.
| Compound Name | [1-amino-2-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]ethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68754048 |
| Molecular Formula | C8H10F3N3O4 |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | [1-amino-2-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]ethyl] 2,2,2-trifluoroacetate |
| SMILES | COCc1nc(CC(N)OC(=O)C(F)(F)F)no1 |
| InChI | InChI=1S/C8H10F3N3O4/c1-16-3-6-13-5(14-18-6)2-4(12)17-7(15)8(9,10)11/h4H,2-3,12H2,1H3 |
| InChIKey | DHGUTFKUJBXRTR-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|