About 7-aminonaphthalene-1,3-disulfinic acid
7-aminonaphthalene-1,3-disulfinic acid (PubChem CID 68754272) has the molecular formula C10H9NO4S2
and a molecular weight of 271.32 g/mol. Its IUPAC name is 7-aminonaphthalene-1,3-disulfinic acid.
Molecular Properties
| Compound Name | 7-aminonaphthalene-1,3-disulfinic acid |
| PubChem CID | 68754272 |
| Molecular Formula | C10H9NO4S2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 7-aminonaphthalene-1,3-disulfinic acid |
| SMILES | Nc1ccc2cc(S(=O)O)cc(S(=O)O)c2c1 |
| InChI | InChI=1S/C10H9NO4S2/c11-7-2-1-6-3-8(16(12)13)5-10(17(14)15)9(6)4-7/h1-5H,11H2,(H,12,13)(H,14,15) |
| InChIKey | FBNYEOMKFOYDSH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 7-aminonaphthalene-1,3-disulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-aminonaphthalene-1,3-disulfinic acid?
The IUPAC name of 7-aminonaphthalene-1,3-disulfinic acid (CID 68754272) is 7-aminonaphthalene-1,3-disulfinic acid.
What is the SMILES notation for 7-aminonaphthalene-1,3-disulfinic acid?
The canonical SMILES for 7-aminonaphthalene-1,3-disulfinic acid is Nc1ccc2cc(S(=O)O)cc(S(=O)O)c2c1.
What is the InChIKey of 7-aminonaphthalene-1,3-disulfinic acid?
The InChIKey is FBNYEOMKFOYDSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO4S2/c11-7-2-1-6-3-8(16(12)13)5-10(17(14)15)9(6)4-7/h1-5H,11H2,(H,12,13)(H,14,15).
What are the key properties of 7-aminonaphthalene-1,3-disulfinic acid?
7-aminonaphthalene-1,3-disulfinic acid has a molecular weight of 271.32 g/mol, XLogP of 1.58, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-aminonaphthalene-1,3-disulfinic acid is sourced from PubChem (CID 68754272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).