About disodium;1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene;carbonate
disodium;1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene;carbonate (PubChem CID 68754681) has the molecular formula C21H36N2Na2O3
and a molecular weight of 410.51 g/mol. Its IUPAC name is disodium;1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene;carbonate.
Molecular Properties
| Compound Name | disodium;1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene;carbonate |
| PubChem CID | 68754681 |
| Molecular Formula | C21H36N2Na2O3 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | disodium;1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene;carbonate |
| SMILES | C1=CCCCC(N2CCCCC/C=N\CCC2)CCCCC1.O=C([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C20H36N2.CH2O3.2Na/c1-2-4-6-10-15-20(14-9-5-3-1)22-18-12-8-7-11-16-21-17-13-19-22;2-1(3)4;;/h1,3,16,20H,2,4-15,17-19H2;(H2,2,3,4);;/q;;2*+1/p-2/b3-1?,21-16-;;; |
| InChIKey | HYUDPJJUEIMCOJ-PPYWWHSBSA-L |
| XLogP | -3.06 |
| TPSA | 78.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze disodium;1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene;carbonate?
The IUPAC name of disodium;1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene;carbonate (CID 68754681) is disodium;1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene;carbonate.
What is the SMILES notation for disodium;1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene;carbonate?
The canonical SMILES for disodium;1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene;carbonate is C1=CCCCC(N2CCCCC/C=N\CCC2)CCCCC1.O=C([O-])[O-].[Na+].[Na+].
What is the InChIKey of disodium;1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene;carbonate?
The InChIKey is HYUDPJJUEIMCOJ-PPYWWHSBSA-L. The full InChI is InChI=1S/C20H36N2.CH2O3.2Na/c1-2-4-6-10-15-20(14-9-5-3-1)22-18-12-8-7-11-16-21-17-13-19-22;2-1(3)4;;/h1,3,16,20H,2,4-15,17-19H2;(H2,2,3,4);;/q;;2*+1/p-2/b3-1?,21-16-;;;.
What are the key properties of disodium;1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene;carbonate?
disodium;1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene;carbonate has a molecular weight of 410.51 g/mol, XLogP of -3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene;carbonate is sourced from PubChem (CID 68754681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).