C12H12O3 — CID 68754708
spiro[3a,4,5,7a-tetrahydro-1-benzofuran-2,4'-pyran]-3-one (PubChem CID 68754708) has the molecular formula C12H12O3 and a molecular weight of 204.23 g/mol. Its IUPAC name is spiro[3a,4,5,7a-tetrahydro-1-benzofuran-2,4'-pyran]-3-one.
| Compound Name | spiro[3a,4,5,7a-tetrahydro-1-benzofuran-2,4'-pyran]-3-one |
|---|---|
| PubChem CID | 68754708 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | spiro[3a,4,5,7a-tetrahydro-1-benzofuran-2,4'-pyran]-3-one |
| SMILES | O=C1C2CCC=CC2OC12C=COC=C2 |
| InChI | InChI=1S/C12H12O3/c13-11-9-3-1-2-4-10(9)15-12(11)5-7-14-8-6-12/h2,4-10H,1,3H2 |
| InChIKey | AJWRYRXEIPSVJL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|